C23H19N3O6S3 — CID 134271155
2-[8-[(1Z,3E)-3-(4-nitrophenyl)sulfinyloxypenta-1,3-dienyl]-6H-cyclohepta[d][1,3]thiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid (PubChem CID 134271155) has the molecular formula C23H19N3O6S3 and a molecular weight of 529.62 g/mol. Its IUPAC name is 2-[8-[(1Z,3E)-3-(4-nitrophenyl)sulfinyloxypenta-1,3-dienyl]-6H-cyclohepta[d][1,3]thiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[8-[(1Z,3E)-3-(4-nitrophenyl)sulfinyloxypenta-1,3-dienyl]-6H-cyclohepta[d][1,3]thiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 134271155 |
| Molecular Formula | C23H19N3O6S3 |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.04 |
| IUPAC Name | 2-[8-[(1Z,3E)-3-(4-nitrophenyl)sulfinyloxypenta-1,3-dienyl]-6H-cyclohepta[d][1,3]thiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| SMILES | C/C=C(\C=C/C1=CCC=Cc2nc(C3=NC(C(=O)O)CS3)sc21)OS(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H19N3O6S3/c1-2-16(32-35(31)17-11-8-15(9-12-17)26(29)30)10-7-14-5-3-4-6-18-20(14)34-22(24-18)21-25-19(13-33-21)23(27)28/h2,4-12,19H,3,13H2,1H3,(H,27,28)/b10-7-,16-2+ |
| InChIKey | GPTKRDIDZUZANO-DVIUMNDESA-N |
| XLogP | 5.00 |
| TPSA | 131.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|