C72H56S — CID 134271458
2,5-bis(12,12,22,22-tetramethyl-9-phenyl-19-hexacyclo[11.11.0.02,11.03,8.015,23.016,21]tetracosa-1(13),2(11),3,5,7,9,14,16(21),17,19,23-undecaenyl)thiophene (PubChem CID 134271458) has the molecular formula C72H56S and a molecular weight of 953.31 g/mol. Its IUPAC name is 2,5-bis(12,12,22,22-tetramethyl-9-phenyl-19-hexacyclo[11.11.0.02,11.03,8.015,23.016,21]tetracosa-1(13),2(11),3,5,7,9,14,16(21),17,19,23-undecaenyl)thiophene.
| Compound Name | 2,5-bis(12,12,22,22-tetramethyl-9-phenyl-19-hexacyclo[11.11.0.02,11.03,8.015,23.016,21]tetracosa-1(13),2(11),3,5,7,9,14,16(21),17,19,23-undecaenyl)thiophene |
|---|---|
| PubChem CID | 134271458 |
| Molecular Formula | C72H56S |
| Molecular Weight | 953.31 g/mol |
| Exact Mass | 952.41 |
| IUPAC Name | 2,5-bis(12,12,22,22-tetramethyl-9-phenyl-19-hexacyclo[11.11.0.02,11.03,8.015,23.016,21]tetracosa-1(13),2(11),3,5,7,9,14,16(21),17,19,23-undecaenyl)thiophene |
| SMILES | CC1(C)c2cc(-c3ccc(-c4ccc5c(c4)C(C)(C)c4cc6c(cc4-5)C(C)(C)c4cc(-c5ccccc5)c5ccccc5c4-6)s3)ccc2-c2cc3c(cc21)-c1c(cc(-c2ccccc2)c2ccccc12)C3(C)C |
| InChI | InChI=1S/C72H56S/c1-69(2)57-33-43(27-29-47(57)53-37-61-55(39-59(53)69)67-49-25-17-15-23-45(49)51(35-63(67)71(61,5)6)41-19-11-9-12-20-41)65-31-32-66(73-65)44-28-30-48-54-38-62-56(40-60(54)70(3,4)58(48)34-44)68-50-26-18-16-24-46(50)52(36-64(68)72(62,7)8)42-21-13-10-14-22-42/h9-40H,1-8H3 |
| InChIKey | CIXXPPRHLAIRLX-UHFFFAOYSA-N |
| XLogP | 19.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.31 |
| LogP ≤ 5 | 19.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |