C46H29F2N3 — CID 134271765
2-[6-(4,6-diphenyl-2-pyridinyl)-9,9-difluorofluoren-3-yl]-4,6-diphenylpyrimidine (PubChem CID 134271765) has the molecular formula C46H29F2N3 and a molecular weight of 661.76 g/mol. Its IUPAC name is 2-[6-(4,6-diphenyl-2-pyridinyl)-9,9-difluorofluoren-3-yl]-4,6-diphenylpyrimidine.
| Compound Name | 2-[6-(4,6-diphenyl-2-pyridinyl)-9,9-difluorofluoren-3-yl]-4,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 134271765 |
| Molecular Formula | C46H29F2N3 |
| Molecular Weight | 661.76 g/mol |
| Exact Mass | 661.23 |
| IUPAC Name | 2-[6-(4,6-diphenyl-2-pyridinyl)-9,9-difluorofluoren-3-yl]-4,6-diphenylpyrimidine |
| SMILES | FC1(F)c2ccc(-c3cc(-c4ccccc4)cc(-c4ccccc4)n3)cc2-c2cc(-c3nc(-c4ccccc4)cc(-c4ccccc4)n3)ccc21 |
| InChI | InChI=1S/C46H29F2N3/c47-46(48)39-23-21-34(42-28-36(30-13-5-1-6-14-30)27-41(49-42)31-15-7-2-8-16-31)25-37(39)38-26-35(22-24-40(38)46)45-50-43(32-17-9-3-10-18-32)29-44(51-45)33-19-11-4-12-20-33/h1-29H |
| InChIKey | BXLJYHYNIKPHKV-UHFFFAOYSA-N |
| XLogP | 11.99 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.76 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |