C44H27F2N5 — CID 134271772
2-[6-(4,6-diphenylpyrimidin-2-yl)-9,9-difluorofluoren-3-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 134271772) has the molecular formula C44H27F2N5 and a molecular weight of 663.73 g/mol. Its IUPAC name is 2-[6-(4,6-diphenylpyrimidin-2-yl)-9,9-difluorofluoren-3-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[6-(4,6-diphenylpyrimidin-2-yl)-9,9-difluorofluoren-3-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 134271772 |
| Molecular Formula | C44H27F2N5 |
| Molecular Weight | 663.73 g/mol |
| Exact Mass | 663.22 |
| IUPAC Name | 2-[6-(4,6-diphenylpyrimidin-2-yl)-9,9-difluorofluoren-3-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | FC1(F)c2ccc(-c3nc(-c4ccccc4)cc(-c4ccccc4)n3)cc2-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc21 |
| InChI | InChI=1S/C44H27F2N5/c45-44(46)36-23-21-32(42-47-38(28-13-5-1-6-14-28)27-39(48-42)29-15-7-2-8-16-29)25-34(36)35-26-33(22-24-37(35)44)43-50-40(30-17-9-3-10-18-30)49-41(51-43)31-19-11-4-12-20-31/h1-27H |
| InChIKey | BHAJRJPUWWIKBP-UHFFFAOYSA-N |
| XLogP | 10.78 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.73 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |