C32H19F2N5 — CID 134271780
2-(9,9-difluoro-6-pyrimidin-2-ylfluoren-3-yl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 134271780) has the molecular formula C32H19F2N5 and a molecular weight of 511.54 g/mol. Its IUPAC name is 2-(9,9-difluoro-6-pyrimidin-2-ylfluoren-3-yl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(9,9-difluoro-6-pyrimidin-2-ylfluoren-3-yl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 134271780 |
| Molecular Formula | C32H19F2N5 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | 2-(9,9-difluoro-6-pyrimidin-2-ylfluoren-3-yl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | FC1(F)c2ccc(-c3ncccn3)cc2-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc21 |
| InChI | InChI=1S/C32H19F2N5/c33-32(34)26-14-12-22(28-35-16-7-17-36-28)18-24(26)25-19-23(13-15-27(25)32)31-38-29(20-8-3-1-4-9-20)37-30(39-31)21-10-5-2-6-11-21/h1-19H |
| InChIKey | JUOQMYSXHQVWLN-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |