About 2-(9,9-difluoro-6-pyridin-2-ylfluoren-3-yl)-4,6-diphenylpyrimidine
2-(9,9-difluoro-6-pyridin-2-ylfluoren-3-yl)-4,6-diphenylpyrimidine (PubChem CID 134271784) has the molecular formula C34H21F2N3
and a molecular weight of 509.56 g/mol. Its IUPAC name is 2-(9,9-difluoro-6-pyridin-2-ylfluoren-3-yl)-4,6-diphenylpyrimidine.
Molecular Properties
| Compound Name | 2-(9,9-difluoro-6-pyridin-2-ylfluoren-3-yl)-4,6-diphenylpyrimidine |
| PubChem CID | 134271784 |
| Molecular Formula | C34H21F2N3 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | 2-(9,9-difluoro-6-pyridin-2-ylfluoren-3-yl)-4,6-diphenylpyrimidine |
| SMILES | FC1(F)c2ccc(-c3ccccn3)cc2-c2cc(-c3nc(-c4ccccc4)cc(-c4ccccc4)n3)ccc21 |
| InChI | InChI=1S/C34H21F2N3/c35-34(36)28-16-14-24(30-13-7-8-18-37-30)19-26(28)27-20-25(15-17-29(27)34)33-38-31(22-9-3-1-4-10-22)21-32(39-33)23-11-5-2-6-12-23/h1-21H |
| InChIKey | OOYNZHLWWMTZFV-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(9,9-difluoro-6-pyridin-2-ylfluoren-3-yl)-4,6-diphenylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(9,9-difluoro-6-pyridin-2-ylfluoren-3-yl)-4,6-diphenylpyrimidine?
The IUPAC name of 2-(9,9-difluoro-6-pyridin-2-ylfluoren-3-yl)-4,6-diphenylpyrimidine (CID 134271784) is 2-(9,9-difluoro-6-pyridin-2-ylfluoren-3-yl)-4,6-diphenylpyrimidine.
What is the SMILES notation for 2-(9,9-difluoro-6-pyridin-2-ylfluoren-3-yl)-4,6-diphenylpyrimidine?
The canonical SMILES for 2-(9,9-difluoro-6-pyridin-2-ylfluoren-3-yl)-4,6-diphenylpyrimidine is FC1(F)c2ccc(-c3ccccn3)cc2-c2cc(-c3nc(-c4ccccc4)cc(-c4ccccc4)n3)ccc21.
What is the InChIKey of 2-(9,9-difluoro-6-pyridin-2-ylfluoren-3-yl)-4,6-diphenylpyrimidine?
The InChIKey is OOYNZHLWWMTZFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H21F2N3/c35-34(36)28-16-14-24(30-13-7-8-18-37-30)19-26(28)27-20-25(15-17-29(27)34)33-38-31(22-9-3-1-4-10-22)21-32(39-33)23-11-5-2-6-12-23/h1-21H.
What are the key properties of 2-(9,9-difluoro-6-pyridin-2-ylfluoren-3-yl)-4,6-diphenylpyrimidine?
2-(9,9-difluoro-6-pyridin-2-ylfluoren-3-yl)-4,6-diphenylpyrimidine has a molecular weight of 509.56 g/mol, XLogP of 8.66, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(9,9-difluoro-6-pyridin-2-ylfluoren-3-yl)-4,6-diphenylpyrimidine is sourced from PubChem (CID 134271784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).