C33H20F2N4 — CID 134271788
2-(9,9-difluoro-6-pyridin-4-ylfluoren-3-yl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 134271788) has the molecular formula C33H20F2N4 and a molecular weight of 510.55 g/mol. Its IUPAC name is 2-(9,9-difluoro-6-pyridin-4-ylfluoren-3-yl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(9,9-difluoro-6-pyridin-4-ylfluoren-3-yl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 134271788 |
| Molecular Formula | C33H20F2N4 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | 2-(9,9-difluoro-6-pyridin-4-ylfluoren-3-yl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | FC1(F)c2ccc(-c3ccncc3)cc2-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc21 |
| InChI | InChI=1S/C33H20F2N4/c34-33(35)28-13-11-24(21-15-17-36-18-16-21)19-26(28)27-20-25(12-14-29(27)33)32-38-30(22-7-3-1-4-8-22)37-31(39-32)23-9-5-2-6-10-23/h1-20H |
| InChIKey | CHVSEJSTXBRROV-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |