C42H25F2N5 — CID 134271811
4-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-difluorofluoren-3-yl]-2-pyridin-2-ylquinoline (PubChem CID 134271811) has the molecular formula C42H25F2N5 and a molecular weight of 637.69 g/mol. Its IUPAC name is 4-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-difluorofluoren-3-yl]-2-pyridin-2-ylquinoline.
| Compound Name | 4-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-difluorofluoren-3-yl]-2-pyridin-2-ylquinoline |
|---|---|
| PubChem CID | 134271811 |
| Molecular Formula | C42H25F2N5 |
| Molecular Weight | 637.69 g/mol |
| Exact Mass | 637.21 |
| IUPAC Name | 4-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-difluorofluoren-3-yl]-2-pyridin-2-ylquinoline |
| SMILES | FC1(F)c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2-c2cc(-c3cc(-c4ccccn4)nc4ccccc34)ccc21 |
| InChI | InChI=1S/C42H25F2N5/c43-42(44)34-20-18-28(31-25-38(37-17-9-10-22-45-37)46-36-16-8-7-15-30(31)36)23-32(34)33-24-29(19-21-35(33)42)41-48-39(26-11-3-1-4-12-26)47-40(49-41)27-13-5-2-6-14-27/h1-25H |
| InChIKey | LKAUTFHGXLQDKS-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.69 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |