C57H36F2N4 — CID 134271869
4-[4-[7-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-9,9-difluorofluoren-2-yl]phenyl]-2,6-diphenylpyrimidine (PubChem CID 134271869) has the molecular formula C57H36F2N4 and a molecular weight of 814.94 g/mol. Its IUPAC name is 4-[4-[7-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-9,9-difluorofluoren-2-yl]phenyl]-2,6-diphenylpyrimidine.
| Compound Name | 4-[4-[7-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-9,9-difluorofluoren-2-yl]phenyl]-2,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 134271869 |
| Molecular Formula | C57H36F2N4 |
| Molecular Weight | 814.94 g/mol |
| Exact Mass | 814.29 |
| IUPAC Name | 4-[4-[7-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-9,9-difluorofluoren-2-yl]phenyl]-2,6-diphenylpyrimidine |
| SMILES | FC1(F)c2cc(-c3ccc(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)ccc2-c2ccc(-c3ccc(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)cc21 |
| InChI | InChI=1S/C57H36F2N4/c58-57(59)49-33-45(37-21-25-41(26-22-37)53-35-51(39-13-5-1-6-14-39)60-55(62-53)43-17-9-3-10-18-43)29-31-47(49)48-32-30-46(34-50(48)57)38-23-27-42(28-24-38)54-36-52(40-15-7-2-8-16-40)61-56(63-54)44-19-11-4-12-20-44/h1-36H |
| InChIKey | TYRMPSWNNQRDQV-UHFFFAOYSA-N |
| XLogP | 14.72 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.94 |
| LogP ≤ 5 | 14.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |