About 3-bromo-6-chloro-9,9-difluorofluorene
3-bromo-6-chloro-9,9-difluorofluorene (PubChem CID 134271927) has the molecular formula C13H6BrClF2
and a molecular weight of 315.54 g/mol. Its IUPAC name is 3-bromo-6-chloro-9,9-difluorofluorene.
Molecular Properties
| Compound Name | 3-bromo-6-chloro-9,9-difluorofluorene |
| PubChem CID | 134271927 |
| Molecular Formula | C13H6BrClF2 |
| Molecular Weight | 315.54 g/mol |
| Exact Mass | 313.93 |
| IUPAC Name | 3-bromo-6-chloro-9,9-difluorofluorene |
| SMILES | FC1(F)c2ccc(Cl)cc2-c2cc(Br)ccc21 |
| InChI | InChI=1S/C13H6BrClF2/c14-7-1-3-11-9(5-7)10-6-8(15)2-4-12(10)13(11,16)17/h1-6H |
| InChIKey | KIAWKHHTXZCHIF-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.54 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-bromo-6-chloro-9,9-difluorofluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-6-chloro-9,9-difluorofluorene?
The IUPAC name of 3-bromo-6-chloro-9,9-difluorofluorene (CID 134271927) is 3-bromo-6-chloro-9,9-difluorofluorene.
What is the SMILES notation for 3-bromo-6-chloro-9,9-difluorofluorene?
The canonical SMILES for 3-bromo-6-chloro-9,9-difluorofluorene is FC1(F)c2ccc(Cl)cc2-c2cc(Br)ccc21.
What is the InChIKey of 3-bromo-6-chloro-9,9-difluorofluorene?
The InChIKey is KIAWKHHTXZCHIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6BrClF2/c14-7-1-3-11-9(5-7)10-6-8(15)2-4-12(10)13(11,16)17/h1-6H.
What are the key properties of 3-bromo-6-chloro-9,9-difluorofluorene?
3-bromo-6-chloro-9,9-difluorofluorene has a molecular weight of 315.54 g/mol, XLogP of 5.22, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-6-chloro-9,9-difluorofluorene is sourced from PubChem (CID 134271927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).