About diethyl 2-phenylethyl phosphate
diethyl 2-phenylethyl phosphate (PubChem CID 13427307) has the molecular formula C12H19O4P
and a molecular weight of 258.25 g/mol. Its IUPAC name is diethyl 2-phenylethyl phosphate.
Molecular Properties
| Compound Name | diethyl 2-phenylethyl phosphate |
| PubChem CID | 13427307 |
| Molecular Formula | C12H19O4P |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | diethyl 2-phenylethyl phosphate |
| SMILES | CCOP(=O)(OCC)OCCc1ccccc1 |
| InChI | InChI=1S/C12H19O4P/c1-3-14-17(13,15-4-2)16-11-10-12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3 |
| InChIKey | LGHXGAOBLJVXOC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-phenylethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-phenylethyl phosphate?
The IUPAC name of diethyl 2-phenylethyl phosphate (CID 13427307) is diethyl 2-phenylethyl phosphate.
What is the SMILES notation for diethyl 2-phenylethyl phosphate?
The canonical SMILES for diethyl 2-phenylethyl phosphate is CCOP(=O)(OCC)OCCc1ccccc1.
What is the InChIKey of diethyl 2-phenylethyl phosphate?
The InChIKey is LGHXGAOBLJVXOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19O4P/c1-3-14-17(13,15-4-2)16-11-10-12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3.
What are the key properties of diethyl 2-phenylethyl phosphate?
diethyl 2-phenylethyl phosphate has a molecular weight of 258.25 g/mol, XLogP of 3.43, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-phenylethyl phosphate is sourced from PubChem (CID 13427307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).