About (E)-1-(2,3-dihydropyridin-5-yl)-4-ethenyloct-4-ene-1,3-dione
(E)-1-(2,3-dihydropyridin-5-yl)-4-ethenyloct-4-ene-1,3-dione (PubChem CID 134274359) has the molecular formula C15H19NO2
and a molecular weight of 245.32 g/mol. Its IUPAC name is (E)-1-(2,3-dihydropyridin-5-yl)-4-ethenyloct-4-ene-1,3-dione.
Molecular Properties
| Compound Name | (E)-1-(2,3-dihydropyridin-5-yl)-4-ethenyloct-4-ene-1,3-dione |
| PubChem CID | 134274359 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (E)-1-(2,3-dihydropyridin-5-yl)-4-ethenyloct-4-ene-1,3-dione |
| SMILES | C=C/C(=C\CCC)C(=O)CC(=O)C1=CCCN=C1 |
| InChI | InChI=1S/C15H19NO2/c1-3-5-7-12(4-2)14(17)10-15(18)13-8-6-9-16-11-13/h4,7-8,11H,2-3,5-6,9-10H2,1H3/b12-7+ |
| InChIKey | YAMYQXWVJSYPDV-KPKJPENVSA-N |
| XLogP | 2.83 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(2,3-dihydropyridin-5-yl)-4-ethenyloct-4-ene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(2,3-dihydropyridin-5-yl)-4-ethenyloct-4-ene-1,3-dione?
The IUPAC name of (E)-1-(2,3-dihydropyridin-5-yl)-4-ethenyloct-4-ene-1,3-dione (CID 134274359) is (E)-1-(2,3-dihydropyridin-5-yl)-4-ethenyloct-4-ene-1,3-dione.
What is the SMILES notation for (E)-1-(2,3-dihydropyridin-5-yl)-4-ethenyloct-4-ene-1,3-dione?
The canonical SMILES for (E)-1-(2,3-dihydropyridin-5-yl)-4-ethenyloct-4-ene-1,3-dione is C=C/C(=C\CCC)C(=O)CC(=O)C1=CCCN=C1.
What is the InChIKey of (E)-1-(2,3-dihydropyridin-5-yl)-4-ethenyloct-4-ene-1,3-dione?
The InChIKey is YAMYQXWVJSYPDV-KPKJPENVSA-N. The full InChI is InChI=1S/C15H19NO2/c1-3-5-7-12(4-2)14(17)10-15(18)13-8-6-9-16-11-13/h4,7-8,11H,2-3,5-6,9-10H2,1H3/b12-7+.
What are the key properties of (E)-1-(2,3-dihydropyridin-5-yl)-4-ethenyloct-4-ene-1,3-dione?
(E)-1-(2,3-dihydropyridin-5-yl)-4-ethenyloct-4-ene-1,3-dione has a molecular weight of 245.32 g/mol, XLogP of 2.83, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(2,3-dihydropyridin-5-yl)-4-ethenyloct-4-ene-1,3-dione is sourced from PubChem (CID 134274359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).