C32H39N5O9 — CID 134274997
[(2R,3R,4R,5S)-2,4-diacetyloxy-6-[[6-[[bis(pyridin-2-ylmethyl)amino]methyl]pyridine-3-carbonyl]-methylamino]-3,5-dihydroxyhexyl] acetate (PubChem CID 134274997) has the molecular formula C32H39N5O9 and a molecular weight of 637.69 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-2,4-diacetyloxy-6-[[6-[[bis(pyridin-2-ylmethyl)amino]methyl]pyridine-3-carbonyl]-methylamino]-3,5-dihydroxyhexyl] acetate.
| Compound Name | [(2R,3R,4R,5S)-2,4-diacetyloxy-6-[[6-[[bis(pyridin-2-ylmethyl)amino]methyl]pyridine-3-carbonyl]-methylamino]-3,5-dihydroxyhexyl] acetate |
|---|---|
| PubChem CID | 134274997 |
| Molecular Formula | C32H39N5O9 |
| Molecular Weight | 637.69 g/mol |
| Exact Mass | 637.27 |
| IUPAC Name | [(2R,3R,4R,5S)-2,4-diacetyloxy-6-[[6-[[bis(pyridin-2-ylmethyl)amino]methyl]pyridine-3-carbonyl]-methylamino]-3,5-dihydroxyhexyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](O)[C@H](OC(C)=O)[C@@H](O)CN(C)C(=O)c1ccc(CN(Cc2ccccn2)Cc2ccccn2)nc1 |
| InChI | InChI=1S/C32H39N5O9/c1-21(38)44-20-29(45-22(2)39)30(42)31(46-23(3)40)28(41)19-36(4)32(43)24-11-12-27(35-15-24)18-37(16-25-9-5-7-13-33-25)17-26-10-6-8-14-34-26/h5-15,28-31,41-42H,16-20H2,1-4H3/t28-,29+,30+,31+/m0/s1 |
| InChIKey | GAGKFFNKKNWRGR-UJOGNLFBSA-N |
| XLogP | 1.29 |
| TPSA | 181.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.69 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|