About 5-imino-6-methyliminocyclohexa-1,3-dien-1-amine
5-imino-6-methyliminocyclohexa-1,3-dien-1-amine (PubChem CID 134275057) has the molecular formula C7H9N3
and a molecular weight of 135.17 g/mol. Its IUPAC name is 5-imino-6-methyliminocyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 5-imino-6-methyliminocyclohexa-1,3-dien-1-amine |
| PubChem CID | 134275057 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 5-imino-6-methyliminocyclohexa-1,3-dien-1-amine |
| SMILES | [H]/N=C1\C=CC=C(N)\C1=N\C |
| InChI | InChI=1S/C7H9N3/c1-10-7-5(8)3-2-4-6(7)9/h2-4,8H,9H2,1H3/b8-5+,10-7+ |
| InChIKey | ZDVCCTUXPBDHQE-FQOLVZPASA-N |
| XLogP | 0.49 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-imino-6-methyliminocyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-imino-6-methyliminocyclohexa-1,3-dien-1-amine?
The IUPAC name of 5-imino-6-methyliminocyclohexa-1,3-dien-1-amine (CID 134275057) is 5-imino-6-methyliminocyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 5-imino-6-methyliminocyclohexa-1,3-dien-1-amine?
The canonical SMILES for 5-imino-6-methyliminocyclohexa-1,3-dien-1-amine is [H]/N=C1\C=CC=C(N)\C1=N\C.
What is the InChIKey of 5-imino-6-methyliminocyclohexa-1,3-dien-1-amine?
The InChIKey is ZDVCCTUXPBDHQE-FQOLVZPASA-N. The full InChI is InChI=1S/C7H9N3/c1-10-7-5(8)3-2-4-6(7)9/h2-4,8H,9H2,1H3/b8-5+,10-7+.
What are the key properties of 5-imino-6-methyliminocyclohexa-1,3-dien-1-amine?
5-imino-6-methyliminocyclohexa-1,3-dien-1-amine has a molecular weight of 135.17 g/mol, XLogP of 0.49, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-imino-6-methyliminocyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 134275057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).