C48H35ClN2S — CID 134275303
3-chloro-5-[12-[(2E,4Z)-hexa-2,4-dien-3-yl]-9-phenyl-[1]benzothiolo[3,2-a]carbazol-6-yl]-N,N-diphenylaniline (PubChem CID 134275303) has the molecular formula C48H35ClN2S and a molecular weight of 707.34 g/mol. Its IUPAC name is 3-chloro-5-[12-[(2E,4Z)-hexa-2,4-dien-3-yl]-9-phenyl-[1]benzothiolo[3,2-a]carbazol-6-yl]-N,N-diphenylaniline.
| Compound Name | 3-chloro-5-[12-[(2E,4Z)-hexa-2,4-dien-3-yl]-9-phenyl-[1]benzothiolo[3,2-a]carbazol-6-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 134275303 |
| Molecular Formula | C48H35ClN2S |
| Molecular Weight | 707.34 g/mol |
| Exact Mass | 706.22 |
| IUPAC Name | 3-chloro-5-[12-[(2E,4Z)-hexa-2,4-dien-3-yl]-9-phenyl-[1]benzothiolo[3,2-a]carbazol-6-yl]-N,N-diphenylaniline |
| SMILES | C/C=C\C(=C/C)n1c2ccc(-c3ccccc3)cc2c2cc(-c3cc(Cl)cc(N(c4ccccc4)c4ccccc4)c3)c3sc4ccccc4c3c21 |
| InChI | InChI=1S/C48H35ClN2S/c1-3-16-36(4-2)51-44-26-25-33(32-17-8-5-9-18-32)29-42(44)43-31-41(48-46(47(43)51)40-23-14-15-24-45(40)52-48)34-27-35(49)30-39(28-34)50(37-19-10-6-11-20-37)38-21-12-7-13-22-38/h3-31H,1-2H3/b16-3-,36-4+ |
| InChIKey | ZDBVFFCQQUVZGR-CBFBGJOMSA-N |
| XLogP | 15.06 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.34 |
| LogP ≤ 5 | 15.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|