About 4-prop-1-en-2-yloxyoxane
4-prop-1-en-2-yloxyoxane (PubChem CID 134275485) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is 4-prop-1-en-2-yloxyoxane.
Molecular Properties
| Compound Name | 4-prop-1-en-2-yloxyoxane |
| PubChem CID | 134275485 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 4-prop-1-en-2-yloxyoxane |
| SMILES | C=C(C)OC1CCOCC1 |
| InChI | InChI=1S/C8H14O2/c1-7(2)10-8-3-5-9-6-4-8/h8H,1,3-6H2,2H3 |
| InChIKey | GGFCOKQSKXSYBD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 4-prop-1-en-2-yloxyoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-prop-1-en-2-yloxyoxane?
The IUPAC name of 4-prop-1-en-2-yloxyoxane (CID 134275485) is 4-prop-1-en-2-yloxyoxane.
What is the SMILES notation for 4-prop-1-en-2-yloxyoxane?
The canonical SMILES for 4-prop-1-en-2-yloxyoxane is C=C(C)OC1CCOCC1.
What is the InChIKey of 4-prop-1-en-2-yloxyoxane?
The InChIKey is GGFCOKQSKXSYBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-7(2)10-8-3-5-9-6-4-8/h8H,1,3-6H2,2H3.
What are the key properties of 4-prop-1-en-2-yloxyoxane?
4-prop-1-en-2-yloxyoxane has a molecular weight of 142.20 g/mol, XLogP of 1.72, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-prop-1-en-2-yloxyoxane is sourced from PubChem (CID 134275485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).