C33H34N8O2 — CID 134275916
4-[(7-amino-9,9-dimethylanthracen-2-ylidene)amino]-N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]butanamide (PubChem CID 134275916) has the molecular formula C33H34N8O2 and a molecular weight of 574.69 g/mol. Its IUPAC name is 4-[(7-amino-9,9-dimethylanthracen-2-ylidene)amino]-N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]butanamide.
| Compound Name | 4-[(7-amino-9,9-dimethylanthracen-2-ylidene)amino]-N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 134275916 |
| Molecular Formula | C33H34N8O2 |
| Molecular Weight | 574.69 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | 4-[(7-amino-9,9-dimethylanthracen-2-ylidene)amino]-N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]butanamide |
| SMILES | CC1(C)C2=C/C(=N/CCCC(=O)NCc3ccc(COc4nc(N)nc5nc[nH]c45)cc3)C=CC2=Cc2ccc(N)cc21 |
| InChI | InChI=1S/C33H34N8O2/c1-33(2)26-15-24(34)11-9-22(26)14-23-10-12-25(16-27(23)33)36-13-3-4-28(42)37-17-20-5-7-21(8-6-20)18-43-31-29-30(39-19-38-29)40-32(35)41-31/h5-12,14-16,19H,3-4,13,17-18,34H2,1-2H3,(H,37,42)(H3,35,38,39,40,41)/b36-25+ |
| InChIKey | RMKSDJRJERYYBT-YRRMYEEHSA-N |
| XLogP | 4.80 |
| TPSA | 157.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.69 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_quin_methide(10)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|