C22H21ClF4N6O — CID 134276087
[(3S,4S)-1-(3-chloro-7-fluoroquinolin-4-yl)-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone (PubChem CID 134276087) has the molecular formula C22H21ClF4N6O and a molecular weight of 496.90 g/mol. Its IUPAC name is [(3S,4S)-1-(3-chloro-7-fluoroquinolin-4-yl)-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone.
| Compound Name | [(3S,4S)-1-(3-chloro-7-fluoroquinolin-4-yl)-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 134276087 |
| Molecular Formula | C22H21ClF4N6O |
| Molecular Weight | 496.90 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | [(3S,4S)-1-(3-chloro-7-fluoroquinolin-4-yl)-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
| SMILES | C[C@@H]1CN(c2c(Cl)cnc3cc(F)ccc23)CC[C@@H]1C(=O)N1CCn2c(nnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C22H21ClF4N6O/c1-12-10-31(19-15-3-2-13(24)8-17(15)28-9-16(19)23)5-4-14(12)20(34)32-6-7-33-18(11-32)29-30-21(33)22(25,26)27/h2-3,8-9,12,14H,4-7,10-11H2,1H3/t12-,14+/m1/s1 |
| InChIKey | XTHUZOCJRDLCTQ-OCCSQVGLSA-N |
| XLogP | 4.14 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.90 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |