C24H26ClF3N6O2 — CID 134276090
[(3S,4S)-1-[3-chloro-7-(1-hydroxyethyl)quinolin-4-yl]-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone (PubChem CID 134276090) has the molecular formula C24H26ClF3N6O2 and a molecular weight of 522.96 g/mol. Its IUPAC name is [(3S,4S)-1-[3-chloro-7-(1-hydroxyethyl)quinolin-4-yl]-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone.
| Compound Name | [(3S,4S)-1-[3-chloro-7-(1-hydroxyethyl)quinolin-4-yl]-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 134276090 |
| Molecular Formula | C24H26ClF3N6O2 |
| Molecular Weight | 522.96 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | [(3S,4S)-1-[3-chloro-7-(1-hydroxyethyl)quinolin-4-yl]-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
| SMILES | CC(O)c1ccc2c(N3CC[C@H](C(=O)N4CCn5c(nnc5C(F)(F)F)C4)[C@H](C)C3)c(Cl)cnc2c1 |
| InChI | InChI=1S/C24H26ClF3N6O2/c1-13-11-32(21-17-4-3-15(14(2)35)9-19(17)29-10-18(21)25)6-5-16(13)22(36)33-7-8-34-20(12-33)30-31-23(34)24(26,27)28/h3-4,9-10,13-14,16,35H,5-8,11-12H2,1-2H3/t13-,14?,16+/m1/s1 |
| InChIKey | RKCBEYXLANKZJB-XIFZVWCKSA-N |
| XLogP | 4.06 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.96 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |