C22H21Cl2F3N6O — CID 134276121
[(3S,4S)-1-(7,8-dichloroquinolin-4-yl)-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone (PubChem CID 134276121) has the molecular formula C22H21Cl2F3N6O and a molecular weight of 513.35 g/mol. Its IUPAC name is [(3S,4S)-1-(7,8-dichloroquinolin-4-yl)-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone.
| Compound Name | [(3S,4S)-1-(7,8-dichloroquinolin-4-yl)-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 134276121 |
| Molecular Formula | C22H21Cl2F3N6O |
| Molecular Weight | 513.35 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | [(3S,4S)-1-(7,8-dichloroquinolin-4-yl)-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
| SMILES | C[C@@H]1CN(c2ccnc3c(Cl)c(Cl)ccc23)CC[C@@H]1C(=O)N1CCn2c(nnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C22H21Cl2F3N6O/c1-12-10-31(16-4-6-28-19-14(16)2-3-15(23)18(19)24)7-5-13(12)20(34)32-8-9-33-17(11-32)29-30-21(33)22(25,26)27/h2-4,6,12-13H,5,7-11H2,1H3/t12-,13+/m1/s1 |
| InChIKey | DWBFLMONMZEJDT-OLZOCXBDSA-N |
| XLogP | 4.66 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.35 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |