C25H23ClF3N7O2 — CID 134276140
[1-[3-chloro-7-(1,3-oxazol-2-yl)quinolin-4-yl]-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone (PubChem CID 134276140) has the molecular formula C25H23ClF3N7O2 and a molecular weight of 545.95 g/mol. Its IUPAC name is [1-[3-chloro-7-(1,3-oxazol-2-yl)quinolin-4-yl]-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone.
| Compound Name | [1-[3-chloro-7-(1,3-oxazol-2-yl)quinolin-4-yl]-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 134276140 |
| Molecular Formula | C25H23ClF3N7O2 |
| Molecular Weight | 545.95 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | [1-[3-chloro-7-(1,3-oxazol-2-yl)quinolin-4-yl]-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
| SMILES | CC1CN(c2c(Cl)cnc3cc(-c4ncco4)ccc23)CCC1C(=O)N1CCn2c(nnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C25H23ClF3N7O2/c1-14-12-34(21-17-3-2-15(22-30-5-9-38-22)10-19(17)31-11-18(21)26)6-4-16(14)23(37)35-7-8-36-20(13-35)32-33-24(36)25(27,28)29/h2-3,5,9-11,14,16H,4,6-8,12-13H2,1H3 |
| InChIKey | CDALCVPCXOZIAO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 93.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.95 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |