C26H23ClF3N5O3 — CID 134276141
[(3S,4S)-1-[3-chloro-7-(1,3-oxazol-2-yl)quinolin-4-yl]-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]methanone (PubChem CID 134276141) has the molecular formula C26H23ClF3N5O3 and a molecular weight of 545.95 g/mol. Its IUPAC name is [(3S,4S)-1-[3-chloro-7-(1,3-oxazol-2-yl)quinolin-4-yl]-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]methanone.
| Compound Name | [(3S,4S)-1-[3-chloro-7-(1,3-oxazol-2-yl)quinolin-4-yl]-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]methanone |
|---|---|
| PubChem CID | 134276141 |
| Molecular Formula | C26H23ClF3N5O3 |
| Molecular Weight | 545.95 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | [(3S,4S)-1-[3-chloro-7-(1,3-oxazol-2-yl)quinolin-4-yl]-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]methanone |
| SMILES | C[C@@H]1CN(c2c(Cl)cnc3cc(-c4ncco4)ccc23)CC[C@@H]1C(=O)N1CCc2c(noc2C(F)(F)F)C1 |
| InChI | InChI=1S/C26H23ClF3N5O3/c1-14-12-34(22-17-3-2-15(24-31-6-9-37-24)10-20(17)32-11-19(22)27)7-4-16(14)25(36)35-8-5-18-21(13-35)33-38-23(18)26(28,29)30/h2-3,6,9-11,14,16H,4-5,7-8,12-13H2,1H3/t14-,16+/m1/s1 |
| InChIKey | LIKYLWYVJHROCG-ZBFHGGJFSA-N |
| XLogP | 5.60 |
| TPSA | 88.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.95 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |