C23H35N — CID 134276164
(3Z,8E,12E)-8-ethylidene-6,6,12-trimethyl-5-methylidene-11-propyltetradeca-3,9,10,12-tetraen-2-imine (PubChem CID 134276164) has the molecular formula C23H35N and a molecular weight of 325.54 g/mol. Its IUPAC name is (3Z,8E,12E)-8-ethylidene-6,6,12-trimethyl-5-methylidene-11-propyltetradeca-3,9,10,12-tetraen-2-imine.
| Compound Name | (3Z,8E,12E)-8-ethylidene-6,6,12-trimethyl-5-methylidene-11-propyltetradeca-3,9,10,12-tetraen-2-imine |
|---|---|
| PubChem CID | 134276164 |
| Molecular Formula | C23H35N |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.28 |
| IUPAC Name | (3Z,8E,12E)-8-ethylidene-6,6,12-trimethyl-5-methylidene-11-propyltetradeca-3,9,10,12-tetraen-2-imine |
| SMILES | [H]/N=C(C)/C=C\C(=C)C(C)(C)C/C(C=C=C(CCC)/C(C)=C/C)=C\C |
| InChI | InChI=1S/C23H35N/c1-9-12-22(18(4)10-2)16-15-21(11-3)17-23(7,8)19(5)13-14-20(6)24/h10-11,13-15,24H,5,9,12,17H2,1-4,6-8H3/b14-13-,18-10+,21-11-,24-20+ |
| InChIKey | FHQHFQFQXMPRQH-WUGHVBNTSA-N |
| XLogP | 7.35 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|