C11H17F7NOP — CID 134276384
[1,1,2,2,3,4,4-heptafluoro-5-(2-pyrrolidin-1-ylethoxy)pentan-3-yl]phosphane (PubChem CID 134276384) has the molecular formula C11H17F7NOP and a molecular weight of 343.22 g/mol. Its IUPAC name is [1,1,2,2,3,4,4-heptafluoro-5-(2-pyrrolidin-1-ylethoxy)pentan-3-yl]phosphane.
| Compound Name | [1,1,2,2,3,4,4-heptafluoro-5-(2-pyrrolidin-1-ylethoxy)pentan-3-yl]phosphane |
|---|---|
| PubChem CID | 134276384 |
| Molecular Formula | C11H17F7NOP |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | [1,1,2,2,3,4,4-heptafluoro-5-(2-pyrrolidin-1-ylethoxy)pentan-3-yl]phosphane |
| SMILES | FC(F)C(F)(F)C(F)(P)C(F)(F)COCCN1CCCC1 |
| InChI | InChI=1S/C11H17F7NOP/c12-8(13)10(16,17)11(18,21)9(14,15)7-20-6-5-19-3-1-2-4-19/h8H,1-7,21H2 |
| InChIKey | MDTWJTVLXOVQGJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|