C13H24F7N2O+ — CID 134276385
2-(2-amino-2,3,3,4,4,5,5-heptafluorohexoxy)ethyl-diethyl-methylazanium (PubChem CID 134276385) has the molecular formula C13H24F7N2O+ and a molecular weight of 357.33 g/mol. Its IUPAC name is 2-(2-amino-2,3,3,4,4,5,5-heptafluorohexoxy)ethyl-diethyl-methylazanium.
| Compound Name | 2-(2-amino-2,3,3,4,4,5,5-heptafluorohexoxy)ethyl-diethyl-methylazanium |
|---|---|
| PubChem CID | 134276385 |
| Molecular Formula | C13H24F7N2O+ |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 2-(2-amino-2,3,3,4,4,5,5-heptafluorohexoxy)ethyl-diethyl-methylazanium |
| SMILES | CC[N+](C)(CC)CCOCC(N)(F)C(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C13H24F7N2O/c1-5-22(4,6-2)7-8-23-9-11(16,21)13(19,20)12(17,18)10(3,14)15/h5-9,21H2,1-4H3/q+1 |
| InChIKey | INTHUFABHHSLIH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|