C19H16N6O — CID 134276641
4-[1-(1-aminoisoquinolin-4-yl)pyrazol-4-yl]-N'-hydroxybenzenecarboximidamide (PubChem CID 134276641) has the molecular formula C19H16N6O and a molecular weight of 344.38 g/mol. Its IUPAC name is 4-[1-(1-aminoisoquinolin-4-yl)pyrazol-4-yl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[1-(1-aminoisoquinolin-4-yl)pyrazol-4-yl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 134276641 |
| Molecular Formula | C19H16N6O |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 4-[1-(1-aminoisoquinolin-4-yl)pyrazol-4-yl]-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N\O)c1ccc(-c2cnn(-c3cnc(N)c4ccccc34)c2)cc1 |
| InChI | InChI=1S/C19H16N6O/c20-18(24-26)13-7-5-12(6-8-13)14-9-23-25(11-14)17-10-22-19(21)16-4-2-1-3-15(16)17/h1-11,26H,(H2,20,24)(H2,21,22) |
| InChIKey | XUAKEMNOOLPPRT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|