About 4-tert-butyl-2-piperidin-1-yl-3,4-dihydropyridine
4-tert-butyl-2-piperidin-1-yl-3,4-dihydropyridine (PubChem CID 134277280) has the molecular formula C14H24N2
and a molecular weight of 220.36 g/mol. Its IUPAC name is 4-tert-butyl-2-piperidin-1-yl-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 4-tert-butyl-2-piperidin-1-yl-3,4-dihydropyridine |
| PubChem CID | 134277280 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 4-tert-butyl-2-piperidin-1-yl-3,4-dihydropyridine |
| SMILES | CC(C)(C)C1C=CN=C(N2CCCCC2)C1 |
| InChI | InChI=1S/C14H24N2/c1-14(2,3)12-7-8-15-13(11-12)16-9-5-4-6-10-16/h7-8,12H,4-6,9-11H2,1-3H3 |
| InChIKey | KBSZZSLTMMAJAU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butyl-2-piperidin-1-yl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2-piperidin-1-yl-3,4-dihydropyridine?
The IUPAC name of 4-tert-butyl-2-piperidin-1-yl-3,4-dihydropyridine (CID 134277280) is 4-tert-butyl-2-piperidin-1-yl-3,4-dihydropyridine.
What is the SMILES notation for 4-tert-butyl-2-piperidin-1-yl-3,4-dihydropyridine?
The canonical SMILES for 4-tert-butyl-2-piperidin-1-yl-3,4-dihydropyridine is CC(C)(C)C1C=CN=C(N2CCCCC2)C1.
What is the InChIKey of 4-tert-butyl-2-piperidin-1-yl-3,4-dihydropyridine?
The InChIKey is KBSZZSLTMMAJAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2/c1-14(2,3)12-7-8-15-13(11-12)16-9-5-4-6-10-16/h7-8,12H,4-6,9-11H2,1-3H3.
What are the key properties of 4-tert-butyl-2-piperidin-1-yl-3,4-dihydropyridine?
4-tert-butyl-2-piperidin-1-yl-3,4-dihydropyridine has a molecular weight of 220.36 g/mol, XLogP of 3.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2-piperidin-1-yl-3,4-dihydropyridine is sourced from PubChem (CID 134277280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).