About 1-(4,6-dimethyl-5-methylideneheptyl)-2-methylguanidine
1-(4,6-dimethyl-5-methylideneheptyl)-2-methylguanidine (PubChem CID 134277371) has the molecular formula C12H25N3
and a molecular weight of 211.35 g/mol. Its IUPAC name is 1-(4,6-dimethyl-5-methylideneheptyl)-2-methylguanidine.
Molecular Properties
| Compound Name | 1-(4,6-dimethyl-5-methylideneheptyl)-2-methylguanidine |
| PubChem CID | 134277371 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | 1-(4,6-dimethyl-5-methylideneheptyl)-2-methylguanidine |
| SMILES | C=C(C(C)C)C(C)CCCN/C(N)=N/C |
| InChI | InChI=1S/C12H25N3/c1-9(2)11(4)10(3)7-6-8-15-12(13)14-5/h9-10H,4,6-8H2,1-3,5H3,(H3,13,14,15) |
| InChIKey | RBKROFSXSALROD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,6-dimethyl-5-methylideneheptyl)-2-methylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,6-dimethyl-5-methylideneheptyl)-2-methylguanidine?
The IUPAC name of 1-(4,6-dimethyl-5-methylideneheptyl)-2-methylguanidine (CID 134277371) is 1-(4,6-dimethyl-5-methylideneheptyl)-2-methylguanidine.
What is the SMILES notation for 1-(4,6-dimethyl-5-methylideneheptyl)-2-methylguanidine?
The canonical SMILES for 1-(4,6-dimethyl-5-methylideneheptyl)-2-methylguanidine is C=C(C(C)C)C(C)CCCN/C(N)=N/C.
What is the InChIKey of 1-(4,6-dimethyl-5-methylideneheptyl)-2-methylguanidine?
The InChIKey is RBKROFSXSALROD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3/c1-9(2)11(4)10(3)7-6-8-15-12(13)14-5/h9-10H,4,6-8H2,1-3,5H3,(H3,13,14,15).
What are the key properties of 1-(4,6-dimethyl-5-methylideneheptyl)-2-methylguanidine?
1-(4,6-dimethyl-5-methylideneheptyl)-2-methylguanidine has a molecular weight of 211.35 g/mol, XLogP of 2.15, 6 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,6-dimethyl-5-methylideneheptyl)-2-methylguanidine is sourced from PubChem (CID 134277371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).