About 5-(difluoromethyl)-2,3-dihydro-1H-pyrazin-6-one
5-(difluoromethyl)-2,3-dihydro-1H-pyrazin-6-one (PubChem CID 134277461) has the molecular formula C5H6F2N2O
and a molecular weight of 148.11 g/mol. Its IUPAC name is 5-(difluoromethyl)-2,3-dihydro-1H-pyrazin-6-one.
Molecular Properties
| Compound Name | 5-(difluoromethyl)-2,3-dihydro-1H-pyrazin-6-one |
| PubChem CID | 134277461 |
| Molecular Formula | C5H6F2N2O |
| Molecular Weight | 148.11 g/mol |
| Exact Mass | 148.04 |
| IUPAC Name | 5-(difluoromethyl)-2,3-dihydro-1H-pyrazin-6-one |
| SMILES | O=C1NCCN=C1C(F)F |
| InChI | InChI=1S/C5H6F2N2O/c6-4(7)3-5(10)9-2-1-8-3/h4H,1-2H2,(H,9,10) |
| InChIKey | AGEOSQSXFDBXKE-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.11 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(difluoromethyl)-2,3-dihydro-1H-pyrazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(difluoromethyl)-2,3-dihydro-1H-pyrazin-6-one?
The IUPAC name of 5-(difluoromethyl)-2,3-dihydro-1H-pyrazin-6-one (CID 134277461) is 5-(difluoromethyl)-2,3-dihydro-1H-pyrazin-6-one.
What is the SMILES notation for 5-(difluoromethyl)-2,3-dihydro-1H-pyrazin-6-one?
The canonical SMILES for 5-(difluoromethyl)-2,3-dihydro-1H-pyrazin-6-one is O=C1NCCN=C1C(F)F.
What is the InChIKey of 5-(difluoromethyl)-2,3-dihydro-1H-pyrazin-6-one?
The InChIKey is AGEOSQSXFDBXKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6F2N2O/c6-4(7)3-5(10)9-2-1-8-3/h4H,1-2H2,(H,9,10).
What are the key properties of 5-(difluoromethyl)-2,3-dihydro-1H-pyrazin-6-one?
5-(difluoromethyl)-2,3-dihydro-1H-pyrazin-6-one has a molecular weight of 148.11 g/mol, XLogP of -0.18, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(difluoromethyl)-2,3-dihydro-1H-pyrazin-6-one is sourced from PubChem (CID 134277461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).