C25H27N5O3S — CID 134277606
5-N-ethyl-2-N-[1-(6-prop-2-enoyl-6-azaspiro[3.4]octan-2-yl)benzimidazol-2-yl]thiophene-2,5-dicarboxamide (PubChem CID 134277606) has the molecular formula C25H27N5O3S and a molecular weight of 477.59 g/mol. Its IUPAC name is 5-N-ethyl-2-N-[1-(6-prop-2-enoyl-6-azaspiro[3.4]octan-2-yl)benzimidazol-2-yl]thiophene-2,5-dicarboxamide.
| Compound Name | 5-N-ethyl-2-N-[1-(6-prop-2-enoyl-6-azaspiro[3.4]octan-2-yl)benzimidazol-2-yl]thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 134277606 |
| Molecular Formula | C25H27N5O3S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 5-N-ethyl-2-N-[1-(6-prop-2-enoyl-6-azaspiro[3.4]octan-2-yl)benzimidazol-2-yl]thiophene-2,5-dicarboxamide |
| SMILES | C=CC(=O)N1CCC2(CC(n3c(NC(=O)c4ccc(C(=O)NCC)s4)nc4ccccc43)C2)C1 |
| InChI | InChI=1S/C25H27N5O3S/c1-3-21(31)29-12-11-25(15-29)13-16(14-25)30-18-8-6-5-7-17(18)27-24(30)28-23(33)20-10-9-19(34-20)22(32)26-4-2/h3,5-10,16H,1,4,11-15H2,2H3,(H,26,32)(H,27,28,33) |
| InChIKey | DPIFGUKPQIBTRZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|