C28H31N5O3S — CID 134277762
5-(cyclopentanecarbonylamino)-N-[1-(6-prop-2-enoyl-6-azaspiro[3.4]octan-2-yl)benzimidazol-2-yl]thiophene-2-carboxamide (PubChem CID 134277762) has the molecular formula C28H31N5O3S and a molecular weight of 517.66 g/mol. Its IUPAC name is 5-(cyclopentanecarbonylamino)-N-[1-(6-prop-2-enoyl-6-azaspiro[3.4]octan-2-yl)benzimidazol-2-yl]thiophene-2-carboxamide.
| Compound Name | 5-(cyclopentanecarbonylamino)-N-[1-(6-prop-2-enoyl-6-azaspiro[3.4]octan-2-yl)benzimidazol-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 134277762 |
| Molecular Formula | C28H31N5O3S |
| Molecular Weight | 517.66 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | 5-(cyclopentanecarbonylamino)-N-[1-(6-prop-2-enoyl-6-azaspiro[3.4]octan-2-yl)benzimidazol-2-yl]thiophene-2-carboxamide |
| SMILES | C=CC(=O)N1CCC2(CC(n3c(NC(=O)c4ccc(NC(=O)C5CCCC5)s4)nc4ccccc43)C2)C1 |
| InChI | InChI=1S/C28H31N5O3S/c1-2-24(34)32-14-13-28(17-32)15-19(16-28)33-21-10-6-5-9-20(21)29-27(33)31-26(36)22-11-12-23(37-22)30-25(35)18-7-3-4-8-18/h2,5-6,9-12,18-19H,1,3-4,7-8,13-17H2,(H,30,35)(H,29,31,36) |
| InChIKey | WJYODWGPCZGFIM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.66 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|