C31H37N5O2S — CID 134277763
N-[5-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]-1-(6-prop-2-enoyl-6-azaspiro[3.4]octan-2-yl)benzimidazol-2-yl]-5-ethynylthiophene-2-carboxamide (PubChem CID 134277763) has the molecular formula C31H37N5O2S and a molecular weight of 543.74 g/mol. Its IUPAC name is N-[5-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]-1-(6-prop-2-enoyl-6-azaspiro[3.4]octan-2-yl)benzimidazol-2-yl]-5-ethynylthiophene-2-carboxamide.
| Compound Name | N-[5-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]-1-(6-prop-2-enoyl-6-azaspiro[3.4]octan-2-yl)benzimidazol-2-yl]-5-ethynylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 134277763 |
| Molecular Formula | C31H37N5O2S |
| Molecular Weight | 543.74 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | N-[5-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]-1-(6-prop-2-enoyl-6-azaspiro[3.4]octan-2-yl)benzimidazol-2-yl]-5-ethynylthiophene-2-carboxamide |
| SMILES | C#Cc1ccc(C(=O)Nc2nc3cc(CN[C@@H](C)C(C)(C)C)ccc3n2C2CC3(CCN(C(=O)C=C)C3)C2)s1 |
| InChI | InChI=1S/C31H37N5O2S/c1-7-23-10-12-26(39-23)28(38)34-29-33-24-15-21(18-32-20(3)30(4,5)6)9-11-25(24)36(29)22-16-31(17-22)13-14-35(19-31)27(37)8-2/h1,8-12,15,20,22,32H,2,13-14,16-19H2,3-6H3,(H,33,34,38)/t20-,22?,31?/m0/s1 |
| InChIKey | JWCAOJUUMHNEDQ-MPSYNJGHSA-N |
| XLogP | 5.60 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.74 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|