C15H26N2 — CID 134277917
(4Z,6Z)-3-(ethylideneamino)-N,N,6,8-tetramethylnona-4,6,8-trien-4-amine (PubChem CID 134277917) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is (4Z,6Z)-3-(ethylideneamino)-N,N,6,8-tetramethylnona-4,6,8-trien-4-amine.
| Compound Name | (4Z,6Z)-3-(ethylideneamino)-N,N,6,8-tetramethylnona-4,6,8-trien-4-amine |
|---|---|
| PubChem CID | 134277917 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | (4Z,6Z)-3-(ethylideneamino)-N,N,6,8-tetramethylnona-4,6,8-trien-4-amine |
| SMILES | C=C(C)/C=C(C)\C=C(\C(CC)/N=C/C)N(C)C |
| InChI | InChI=1S/C15H26N2/c1-8-14(16-9-2)15(17(6)7)11-13(5)10-12(3)4/h9-11,14H,3,8H2,1-2,4-7H3/b13-10-,15-11-,16-9+ |
| InChIKey | BTNDQVCYMOJHSH-XYXXJRIQSA-N |
| XLogP | 3.82 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|