C11H12N2O — CID 134278061
4-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,3-dihydroimidazol-2-one (PubChem CID 134278061) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 4-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,3-dihydroimidazol-2-one.
| Compound Name | 4-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,3-dihydroimidazol-2-one |
|---|---|
| PubChem CID | 134278061 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 4-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,3-dihydroimidazol-2-one |
| SMILES | C=C/C=C\C(=C/C=C)c1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C11H12N2O/c1-3-5-7-9(6-4-2)10-8-12-11(14)13-10/h3-8H,1-2H2,(H2,12,13,14)/b7-5-,9-6+ |
| InChIKey | WVTDKNLPXDHZFH-XCZNYUDNSA-N |
| XLogP | 2.01 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|