C28H26N4O4S — CID 134278239
2-methylsulfonyl-N-[(3S,4R)-3-phenyl-1-(quinoxaline-6-carbonyl)piperidin-4-yl]benzamide (PubChem CID 134278239) has the molecular formula C28H26N4O4S and a molecular weight of 514.61 g/mol. Its IUPAC name is 2-methylsulfonyl-N-[(3S,4R)-3-phenyl-1-(quinoxaline-6-carbonyl)piperidin-4-yl]benzamide.
| Compound Name | 2-methylsulfonyl-N-[(3S,4R)-3-phenyl-1-(quinoxaline-6-carbonyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 134278239 |
| Molecular Formula | C28H26N4O4S |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | 2-methylsulfonyl-N-[(3S,4R)-3-phenyl-1-(quinoxaline-6-carbonyl)piperidin-4-yl]benzamide |
| SMILES | CS(=O)(=O)c1ccccc1C(=O)N[C@@H]1CCN(C(=O)c2ccc3nccnc3c2)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C28H26N4O4S/c1-37(35,36)26-10-6-5-9-21(26)27(33)31-23-13-16-32(18-22(23)19-7-3-2-4-8-19)28(34)20-11-12-24-25(17-20)30-15-14-29-24/h2-12,14-15,17,22-23H,13,16,18H2,1H3,(H,31,33)/t22-,23-/m1/s1 |
| InChIKey | JBXJHMFITKLQDH-DHIUTWEWSA-N |
| XLogP | 3.46 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |