C12H18N4O2 — CID 134279142
(7S)-2-(2,6-dimethylpyrimidin-4-yl)-7-methyl-1,2,5-oxadiazepane-5-carbaldehyde (PubChem CID 134279142) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is (7S)-2-(2,6-dimethylpyrimidin-4-yl)-7-methyl-1,2,5-oxadiazepane-5-carbaldehyde.
| Compound Name | (7S)-2-(2,6-dimethylpyrimidin-4-yl)-7-methyl-1,2,5-oxadiazepane-5-carbaldehyde |
|---|---|
| PubChem CID | 134279142 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (7S)-2-(2,6-dimethylpyrimidin-4-yl)-7-methyl-1,2,5-oxadiazepane-5-carbaldehyde |
| SMILES | Cc1cc(N2CCN(C=O)C[C@H](C)O2)nc(C)n1 |
| InChI | InChI=1S/C12H18N4O2/c1-9-6-12(14-11(3)13-9)16-5-4-15(8-17)7-10(2)18-16/h6,8,10H,4-5,7H2,1-3H3/t10-/m0/s1 |
| InChIKey | UPQLKMHLERCSKL-JTQLQIEISA-N |
| XLogP | 0.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|