About 4-cyclopentylmorpholine
4-cyclopentylmorpholine (PubChem CID 13428024) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is 4-cyclopentylmorpholine.
Molecular Properties
| Compound Name | 4-cyclopentylmorpholine |
| PubChem CID | 13428024 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 4-cyclopentylmorpholine |
| SMILES | C1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C9H17NO/c1-2-4-9(3-1)10-5-7-11-8-6-10/h9H,1-8H2 |
| InChIKey | WQSGOPRYLPXKNG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclopentylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopentylmorpholine?
The IUPAC name of 4-cyclopentylmorpholine (CID 13428024) is 4-cyclopentylmorpholine.
What is the SMILES notation for 4-cyclopentylmorpholine?
The canonical SMILES for 4-cyclopentylmorpholine is C1CCC(N2CCOCC2)C1.
What is the InChIKey of 4-cyclopentylmorpholine?
The InChIKey is WQSGOPRYLPXKNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO/c1-2-4-9(3-1)10-5-7-11-8-6-10/h9H,1-8H2.
What are the key properties of 4-cyclopentylmorpholine?
4-cyclopentylmorpholine has a molecular weight of 155.24 g/mol, XLogP of 1.26, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopentylmorpholine is sourced from PubChem (CID 13428024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).