C24H35NO6 — CID 134280443
[3-tert-butyl-2,5,7,8-tetramethyl-2-(5-nitrohex-4-enyl)-3,4-dihydrochromen-6-yl] hydrogen carbonate (PubChem CID 134280443) has the molecular formula C24H35NO6 and a molecular weight of 433.55 g/mol. Its IUPAC name is [3-tert-butyl-2,5,7,8-tetramethyl-2-(5-nitrohex-4-enyl)-3,4-dihydrochromen-6-yl] hydrogen carbonate.
| Compound Name | [3-tert-butyl-2,5,7,8-tetramethyl-2-(5-nitrohex-4-enyl)-3,4-dihydrochromen-6-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 134280443 |
| Molecular Formula | C24H35NO6 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | [3-tert-butyl-2,5,7,8-tetramethyl-2-(5-nitrohex-4-enyl)-3,4-dihydrochromen-6-yl] hydrogen carbonate |
| SMILES | CC(=CCCCC1(C)Oc2c(C)c(C)c(OC(=O)O)c(C)c2CC1C(C)(C)C)[N+](=O)[O-] |
| InChI | InChI=1S/C24H35NO6/c1-14(25(28)29)11-9-10-12-24(8)19(23(5,6)7)13-18-17(4)20(30-22(26)27)15(2)16(3)21(18)31-24/h11,19H,9-10,12-13H2,1-8H3,(H,26,27) |
| InChIKey | PSNNBLKVSHEDOK-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|