C10H18O3 — CID 13428080
(1R,2R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylbut-3-en-1-ol (PubChem CID 13428080) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (1R,2R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylbut-3-en-1-ol.
| Compound Name | (1R,2R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylbut-3-en-1-ol |
|---|---|
| PubChem CID | 13428080 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (1R,2R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylbut-3-en-1-ol |
| SMILES | C=C[C@@H](C)[C@@H](O)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C10H18O3/c1-5-7(2)9(11)8-6-12-10(3,4)13-8/h5,7-9,11H,1,6H2,2-4H3/t7-,8+,9-/m1/s1 |
| InChIKey | VAOCFOGHGZRAEN-HRDYMLBCSA-N |
| XLogP | 1.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|