C16H18F4N4 — CID 134280986
5-[1-(3-fluorocyclobutyl)-2-propan-2-ylimidazol-4-yl]-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 134280986) has the molecular formula C16H18F4N4 and a molecular weight of 342.34 g/mol. Its IUPAC name is 5-[1-(3-fluorocyclobutyl)-2-propan-2-ylimidazol-4-yl]-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-[1-(3-fluorocyclobutyl)-2-propan-2-ylimidazol-4-yl]-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 134280986 |
| Molecular Formula | C16H18F4N4 |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 5-[1-(3-fluorocyclobutyl)-2-propan-2-ylimidazol-4-yl]-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC(C)c1nc(-c2cnc(N)c(C(F)(F)F)c2)cn1C1CC(F)C1 |
| InChI | InChI=1S/C16H18F4N4/c1-8(2)15-23-13(7-24(15)11-4-10(17)5-11)9-3-12(16(18,19)20)14(21)22-6-9/h3,6-8,10-11H,4-5H2,1-2H3,(H2,21,22) |
| InChIKey | BSUNXSVZKSJGRW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |