About 9-(cyclopentylmethyl)carbazole-2,7-diamine;dihydrochloride
9-(cyclopentylmethyl)carbazole-2,7-diamine;dihydrochloride (PubChem CID 134281116) has the molecular formula C18H23Cl2N3
and a molecular weight of 352.31 g/mol. Its IUPAC name is 9-(cyclopentylmethyl)carbazole-2,7-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 9-(cyclopentylmethyl)carbazole-2,7-diamine;dihydrochloride |
| PubChem CID | 134281116 |
| Molecular Formula | C18H23Cl2N3 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 9-(cyclopentylmethyl)carbazole-2,7-diamine;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc2c3ccc(N)cc3n(CC3CCCC3)c2c1 |
| InChI | InChI=1S/C18H21N3.2ClH/c19-13-5-7-15-16-8-6-14(20)10-18(16)21(17(15)9-13)11-12-3-1-2-4-12;;/h5-10,12H,1-4,11,19-20H2;2*1H |
| InChIKey | HZWPWLQAQHHALQ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 56.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 9-(cyclopentylmethyl)carbazole-2,7-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(cyclopentylmethyl)carbazole-2,7-diamine;dihydrochloride?
The IUPAC name of 9-(cyclopentylmethyl)carbazole-2,7-diamine;dihydrochloride (CID 134281116) is 9-(cyclopentylmethyl)carbazole-2,7-diamine;dihydrochloride.
What is the SMILES notation for 9-(cyclopentylmethyl)carbazole-2,7-diamine;dihydrochloride?
The canonical SMILES for 9-(cyclopentylmethyl)carbazole-2,7-diamine;dihydrochloride is Cl.Cl.Nc1ccc2c3ccc(N)cc3n(CC3CCCC3)c2c1.
What is the InChIKey of 9-(cyclopentylmethyl)carbazole-2,7-diamine;dihydrochloride?
The InChIKey is HZWPWLQAQHHALQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3.2ClH/c19-13-5-7-15-16-8-6-14(20)10-18(16)21(17(15)9-13)11-12-3-1-2-4-12;;/h5-10,12H,1-4,11,19-20H2;2*1H.
What are the key properties of 9-(cyclopentylmethyl)carbazole-2,7-diamine;dihydrochloride?
9-(cyclopentylmethyl)carbazole-2,7-diamine;dihydrochloride has a molecular weight of 352.31 g/mol, XLogP of 4.99, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(cyclopentylmethyl)carbazole-2,7-diamine;dihydrochloride is sourced from PubChem (CID 134281116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).