C22H21N7O5S — CID 134281337
N-[3-[(2-methylsulfonyl-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl)amino]phenyl]-4-nitrobenzamide (PubChem CID 134281337) has the molecular formula C22H21N7O5S and a molecular weight of 495.52 g/mol. Its IUPAC name is N-[3-[(2-methylsulfonyl-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl)amino]phenyl]-4-nitrobenzamide.
| Compound Name | N-[3-[(2-methylsulfonyl-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl)amino]phenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 134281337 |
| Molecular Formula | C22H21N7O5S |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | N-[3-[(2-methylsulfonyl-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl)amino]phenyl]-4-nitrobenzamide |
| SMILES | CC(C)c1cnn2c(Nc3cccc(NC(=O)c4ccc([N+](=O)[O-])cc4)c3)nc(S(C)(=O)=O)nc12 |
| InChI | InChI=1S/C22H21N7O5S/c1-13(2)18-12-23-28-19(18)26-22(35(3,33)34)27-21(28)25-16-6-4-5-15(11-16)24-20(30)14-7-9-17(10-8-14)29(31)32/h4-13H,1-3H3,(H,24,30)(H,25,26,27) |
| InChIKey | QMBPMTMXFDPZEG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 161.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|