C23H24ClF4N7O3S — CID 134281547
(3R)-3-[5-[1-(5-chloro-2-pyridinyl)triazol-4-yl]-2-fluorophenyl]-3,6,6-trimethyl-1-methylimino-1-oxo-2H-1,4-thiazin-5-amine;2,2,2-trifluoroacetic acid (PubChem CID 134281547) has the molecular formula C23H24ClF4N7O3S and a molecular weight of 590.00 g/mol. Its IUPAC name is (3R)-3-[5-[1-(5-chloro-2-pyridinyl)triazol-4-yl]-2-fluorophenyl]-3,6,6-trimethyl-1-methylimino-1-oxo-2H-1,4-thiazin-5-amine;2,2,2-trifluoroacetic acid.
| Compound Name | (3R)-3-[5-[1-(5-chloro-2-pyridinyl)triazol-4-yl]-2-fluorophenyl]-3,6,6-trimethyl-1-methylimino-1-oxo-2H-1,4-thiazin-5-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 134281547 |
| Molecular Formula | C23H24ClF4N7O3S |
| Molecular Weight | 590.00 g/mol |
| Exact Mass | 589.13 |
| IUPAC Name | (3R)-3-[5-[1-(5-chloro-2-pyridinyl)triazol-4-yl]-2-fluorophenyl]-3,6,6-trimethyl-1-methylimino-1-oxo-2H-1,4-thiazin-5-amine;2,2,2-trifluoroacetic acid |
| SMILES | CN=S1(=O)C[C@@](C)(c2cc(-c3cn(-c4ccc(Cl)cn4)nn3)ccc2F)N=C(N)C1(C)C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H23ClFN7OS.C2HF3O2/c1-20(2)19(24)27-21(3,12-32(20,31)25-4)15-9-13(5-7-16(15)23)17-11-30(29-28-17)18-8-6-14(22)10-26-18;3-2(4,5)1(6)7/h5-11H,12H2,1-4H3,(H2,24,27);(H,6,7)/t21-,32?;/m0./s1 |
| InChIKey | VKCSLLODVCJRQQ-PCTZJKPCSA-N |
| XLogP | 4.22 |
| TPSA | 148.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.00 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |