C20H20F3NO5S — CID 134281906
2-[(1S,2S)-2-(2,3-difluorophenyl)-2-(4-fluorophenyl)-1-methylsulfonyloxyethyl]pyrrolidine-1-carboxylic acid (PubChem CID 134281906) has the molecular formula C20H20F3NO5S and a molecular weight of 443.44 g/mol. Its IUPAC name is 2-[(1S,2S)-2-(2,3-difluorophenyl)-2-(4-fluorophenyl)-1-methylsulfonyloxyethyl]pyrrolidine-1-carboxylic acid.
| Compound Name | 2-[(1S,2S)-2-(2,3-difluorophenyl)-2-(4-fluorophenyl)-1-methylsulfonyloxyethyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 134281906 |
| Molecular Formula | C20H20F3NO5S |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 2-[(1S,2S)-2-(2,3-difluorophenyl)-2-(4-fluorophenyl)-1-methylsulfonyloxyethyl]pyrrolidine-1-carboxylic acid |
| SMILES | CS(=O)(=O)O[C@H](C1CCCN1C(=O)O)[C@@H](c1ccc(F)cc1)c1cccc(F)c1F |
| InChI | InChI=1S/C20H20F3NO5S/c1-30(27,28)29-19(16-6-3-11-24(16)20(25)26)17(12-7-9-13(21)10-8-12)14-4-2-5-15(22)18(14)23/h2,4-5,7-10,16-17,19H,3,6,11H2,1H3,(H,25,26)/t16?,17-,19+/m0/s1 |
| InChIKey | MJIGPJMWKJRWIP-WFTITGEASA-N |
| XLogP | 3.72 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|