C25H29FN2O5S — CID 134281972
tert-butyl 2-[(1R,2R)-2-(4-cyanophenyl)-2-(3-fluorophenyl)-1-methylsulfonyloxyethyl]pyrrolidine-1-carboxylate (PubChem CID 134281972) has the molecular formula C25H29FN2O5S and a molecular weight of 488.58 g/mol. Its IUPAC name is tert-butyl 2-[(1R,2R)-2-(4-cyanophenyl)-2-(3-fluorophenyl)-1-methylsulfonyloxyethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(1R,2R)-2-(4-cyanophenyl)-2-(3-fluorophenyl)-1-methylsulfonyloxyethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134281972 |
| Molecular Formula | C25H29FN2O5S |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | tert-butyl 2-[(1R,2R)-2-(4-cyanophenyl)-2-(3-fluorophenyl)-1-methylsulfonyloxyethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1[C@H](OS(C)(=O)=O)[C@H](c1ccc(C#N)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C25H29FN2O5S/c1-25(2,3)32-24(29)28-14-6-9-21(28)23(33-34(4,30)31)22(19-7-5-8-20(26)15-19)18-12-10-17(16-27)11-13-18/h5,7-8,10-13,15,21-23H,6,9,14H2,1-4H3/t21?,22-,23+/m1/s1 |
| InChIKey | TURQMIZSGPJOOG-NRSZHQCHSA-N |
| XLogP | 4.57 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|