About tert-butyl (2R)-2-[(2S,3S)-3-(3-fluorophenyl)oxiran-2-yl]pyrrolidine-1-carboxylate
tert-butyl (2R)-2-[(2S,3S)-3-(3-fluorophenyl)oxiran-2-yl]pyrrolidine-1-carboxylate (PubChem CID 134282044) has the molecular formula C17H22FNO3
and a molecular weight of 307.37 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(2S,3S)-3-(3-fluorophenyl)oxiran-2-yl]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2R)-2-[(2S,3S)-3-(3-fluorophenyl)oxiran-2-yl]pyrrolidine-1-carboxylate |
| PubChem CID | 134282044 |
| Molecular Formula | C17H22FNO3 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | tert-butyl (2R)-2-[(2S,3S)-3-(3-fluorophenyl)oxiran-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1[C@@H]1O[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C17H22FNO3/c1-17(2,3)22-16(20)19-9-5-8-13(19)15-14(21-15)11-6-4-7-12(18)10-11/h4,6-7,10,13-15H,5,8-9H2,1-3H3/t13-,14+,15+/m1/s1 |
| InChIKey | DWAKSLXXGJVHOB-ILXRZTDVSA-N |
| XLogP | 3.67 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2R)-2-[(2S,3S)-3-(3-fluorophenyl)oxiran-2-yl]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R)-2-[(2S,3S)-3-(3-fluorophenyl)oxiran-2-yl]pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2R)-2-[(2S,3S)-3-(3-fluorophenyl)oxiran-2-yl]pyrrolidine-1-carboxylate (CID 134282044) is tert-butyl (2R)-2-[(2S,3S)-3-(3-fluorophenyl)oxiran-2-yl]pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2R)-2-[(2S,3S)-3-(3-fluorophenyl)oxiran-2-yl]pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2R)-2-[(2S,3S)-3-(3-fluorophenyl)oxiran-2-yl]pyrrolidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC[C@@H]1[C@@H]1O[C@H]1c1cccc(F)c1.
What is the InChIKey of tert-butyl (2R)-2-[(2S,3S)-3-(3-fluorophenyl)oxiran-2-yl]pyrrolidine-1-carboxylate?
The InChIKey is DWAKSLXXGJVHOB-ILXRZTDVSA-N. The full InChI is InChI=1S/C17H22FNO3/c1-17(2,3)22-16(20)19-9-5-8-13(19)15-14(21-15)11-6-4-7-12(18)10-11/h4,6-7,10,13-15H,5,8-9H2,1-3H3/t13-,14+,15+/m1/s1.
What are the key properties of tert-butyl (2R)-2-[(2S,3S)-3-(3-fluorophenyl)oxiran-2-yl]pyrrolidine-1-carboxylate?
tert-butyl (2R)-2-[(2S,3S)-3-(3-fluorophenyl)oxiran-2-yl]pyrrolidine-1-carboxylate has a molecular weight of 307.37 g/mol, XLogP of 3.67, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R)-2-[(2S,3S)-3-(3-fluorophenyl)oxiran-2-yl]pyrrolidine-1-carboxylate is sourced from PubChem (CID 134282044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).