C19H20F3NO3S — CID 134282086
[(1R,2R)-2-(2,3-difluorophenyl)-2-(4-fluorophenyl)-1-[(2R)-pyrrolidin-2-yl]ethyl] methanesulfonate (PubChem CID 134282086) has the molecular formula C19H20F3NO3S and a molecular weight of 399.43 g/mol. Its IUPAC name is [(1R,2R)-2-(2,3-difluorophenyl)-2-(4-fluorophenyl)-1-[(2R)-pyrrolidin-2-yl]ethyl] methanesulfonate.
| Compound Name | [(1R,2R)-2-(2,3-difluorophenyl)-2-(4-fluorophenyl)-1-[(2R)-pyrrolidin-2-yl]ethyl] methanesulfonate |
|---|---|
| PubChem CID | 134282086 |
| Molecular Formula | C19H20F3NO3S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | [(1R,2R)-2-(2,3-difluorophenyl)-2-(4-fluorophenyl)-1-[(2R)-pyrrolidin-2-yl]ethyl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@H]([C@H](c1ccc(F)cc1)c1cccc(F)c1F)[C@H]1CCCN1 |
| InChI | InChI=1S/C19H20F3NO3S/c1-27(24,25)26-19(16-6-3-11-23-16)17(12-7-9-13(20)10-8-12)14-4-2-5-15(21)18(14)22/h2,4-5,7-10,16-17,19,23H,3,6,11H2,1H3/t16-,17-,19+/m1/s1 |
| InChIKey | WOCWURMGNXRIBX-LMMKCTJWSA-N |
| XLogP | 3.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|