C13H13F2NO3 — CID 134282106
2-[(2S,3S)-3-(2,3-difluorophenyl)oxiran-2-yl]pyrrolidine-1-carboxylic acid (PubChem CID 134282106) has the molecular formula C13H13F2NO3 and a molecular weight of 269.25 g/mol. Its IUPAC name is 2-[(2S,3S)-3-(2,3-difluorophenyl)oxiran-2-yl]pyrrolidine-1-carboxylic acid.
| Compound Name | 2-[(2S,3S)-3-(2,3-difluorophenyl)oxiran-2-yl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 134282106 |
| Molecular Formula | C13H13F2NO3 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 2-[(2S,3S)-3-(2,3-difluorophenyl)oxiran-2-yl]pyrrolidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCCC1[C@@H]1O[C@H]1c1cccc(F)c1F |
| InChI | InChI=1S/C13H13F2NO3/c14-8-4-1-3-7(10(8)15)11-12(19-11)9-5-2-6-16(9)13(17)18/h1,3-4,9,11-12H,2,5-6H2,(H,17,18)/t9?,11-,12-/m0/s1 |
| InChIKey | GAJIXLAVFKFZSZ-WEBCLNCGSA-N |
| XLogP | 2.55 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|