About 7-bromo-4-pyridin-2-yl-2,3-dihydro-1,4-benzoxazine
7-bromo-4-pyridin-2-yl-2,3-dihydro-1,4-benzoxazine (PubChem CID 134282335) has the molecular formula C13H11BrN2O
and a molecular weight of 291.15 g/mol. Its IUPAC name is 7-bromo-4-pyridin-2-yl-2,3-dihydro-1,4-benzoxazine.
Molecular Properties
| Compound Name | 7-bromo-4-pyridin-2-yl-2,3-dihydro-1,4-benzoxazine |
| PubChem CID | 134282335 |
| Molecular Formula | C13H11BrN2O |
| Molecular Weight | 291.15 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 7-bromo-4-pyridin-2-yl-2,3-dihydro-1,4-benzoxazine |
| SMILES | Brc1ccc2c(c1)OCCN2c1ccccn1 |
| InChI | InChI=1S/C13H11BrN2O/c14-10-4-5-11-12(9-10)17-8-7-16(11)13-3-1-2-6-15-13/h1-6,9H,7-8H2 |
| InChIKey | POSMJRFNFQADAY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.15 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-bromo-4-pyridin-2-yl-2,3-dihydro-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-4-pyridin-2-yl-2,3-dihydro-1,4-benzoxazine?
The IUPAC name of 7-bromo-4-pyridin-2-yl-2,3-dihydro-1,4-benzoxazine (CID 134282335) is 7-bromo-4-pyridin-2-yl-2,3-dihydro-1,4-benzoxazine.
What is the SMILES notation for 7-bromo-4-pyridin-2-yl-2,3-dihydro-1,4-benzoxazine?
The canonical SMILES for 7-bromo-4-pyridin-2-yl-2,3-dihydro-1,4-benzoxazine is Brc1ccc2c(c1)OCCN2c1ccccn1.
What is the InChIKey of 7-bromo-4-pyridin-2-yl-2,3-dihydro-1,4-benzoxazine?
The InChIKey is POSMJRFNFQADAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrN2O/c14-10-4-5-11-12(9-10)17-8-7-16(11)13-3-1-2-6-15-13/h1-6,9H,7-8H2.
What are the key properties of 7-bromo-4-pyridin-2-yl-2,3-dihydro-1,4-benzoxazine?
7-bromo-4-pyridin-2-yl-2,3-dihydro-1,4-benzoxazine has a molecular weight of 291.15 g/mol, XLogP of 3.37, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-4-pyridin-2-yl-2,3-dihydro-1,4-benzoxazine is sourced from PubChem (CID 134282335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).