About (2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)-(2-methylphenyl)methanone
(2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)-(2-methylphenyl)methanone (PubChem CID 134282882) has the molecular formula C14H9Cl2N3O
and a molecular weight of 306.15 g/mol. Its IUPAC name is (2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)-(2-methylphenyl)methanone.
Molecular Properties
| Compound Name | (2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)-(2-methylphenyl)methanone |
| PubChem CID | 134282882 |
| Molecular Formula | C14H9Cl2N3O |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | (2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)-(2-methylphenyl)methanone |
| SMILES | Cc1ccccc1C(=O)c1c[nH]c2nc(Cl)nc(Cl)c12 |
| InChI | InChI=1S/C14H9Cl2N3O/c1-7-4-2-3-5-8(7)11(20)9-6-17-13-10(9)12(15)18-14(16)19-13/h2-6H,1H3,(H,17,18,19) |
| InChIKey | JVNDEXHRHAAFCU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)-(2-methylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)-(2-methylphenyl)methanone?
The IUPAC name of (2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)-(2-methylphenyl)methanone (CID 134282882) is (2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)-(2-methylphenyl)methanone.
What is the SMILES notation for (2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)-(2-methylphenyl)methanone?
The canonical SMILES for (2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)-(2-methylphenyl)methanone is Cc1ccccc1C(=O)c1c[nH]c2nc(Cl)nc(Cl)c12.
What is the InChIKey of (2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)-(2-methylphenyl)methanone?
The InChIKey is JVNDEXHRHAAFCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9Cl2N3O/c1-7-4-2-3-5-8(7)11(20)9-6-17-13-10(9)12(15)18-14(16)19-13/h2-6H,1H3,(H,17,18,19).
What are the key properties of (2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)-(2-methylphenyl)methanone?
(2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)-(2-methylphenyl)methanone has a molecular weight of 306.15 g/mol, XLogP of 3.80, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)-(2-methylphenyl)methanone is sourced from PubChem (CID 134282882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).